Diethyl(phenylacetyl)malonate

1.Product Introduction

MF： C15H18O5

MW： 278.3

CAS： 20320-59-6

EINECS：205-854-1

2.Introduction to

Diethyl phenyllevulmalonate contains two ester bonds, which are relatively low in reactivity, but can be hydrolyzed with appropriate catalysts to produce compounds such as phenylacetic acid and ethanol. The compound can also undergo transesterification Chemicalbook reactions with other alcohols to produce different ester compounds. For example, methyl phenacemalonate can be obtained by reacting with methanol. Phenyllevulmalonic acid can be generated from the compound by acid-catalyzed hydrolysis reaction, and phenylacetic acid and diethyl malonate can be obtained by further adding water.

3.use

Diethyl phenyllevulmalonic acid contains two strong hydrophobic ethyl acetate groups in its molecular structure, so that it has a certain hydrophobicity, the compound is not easy to dissolve in water, but has good solubility in Chemicalbook machine solvents, such as ethanol, ether, benzene and so on. Diethyl phenyllevulmalonate is a kind of intermediate in organic synthesis, which is used to synthesize heterocyclic compounds in organic chemistry.

4.

boiling point:120 °C(Press: 0.01 Torr)

Density:1.148±0.06 g/cm3(Predicted)

Acidity coefficient (pKa):8.76±0.59(Predicted)

InChI:InChI=1S/C15H18O5/c1-3-19-14(17)13(15(18)20-4-2)12(16)10-11-8-6-5-7-9-11/h5-9,13H,3-4,10H2,1-2H3

InChIKey:ZASPDQDIPTZTQQ-UHFFFAOYSA-N

SMILES:C(OCC)(=O)C(C(CC1=CC=CC=C1)=O)C(OCC)=O